|
[摘要]:Zincke salts having chiral anions were obtained by the anion exchange reaction of Zincke salts having a chloride anion with R-(-)- or S-(+)-binaphthylphospholic acid sodium salts (R-BINAP-PO4Na and S-BINAP-PO4Na). The anion exchange behavior was investigated by photoluminescence measurements. The circular dichroism (CD) spectra of the Zincke salts having R-BINAP-PO4- or S-BINAP-PO4- showed relatively strong negative and positive Cotton effects, respectively. |
|